C16H24ClN3O2 — CID 138047573
1-[2-(3-chlorophenyl)-2-methoxyethyl]-3-[[1-(methylamino)cyclobutyl]methyl]urea (PubChem CID 138047573) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-methoxyethyl]-3-[[1-(methylamino)cyclobutyl]methyl]urea.
| Compound Name | 1-[2-(3-chlorophenyl)-2-methoxyethyl]-3-[[1-(methylamino)cyclobutyl]methyl]urea |
|---|---|
| PubChem CID | 138047573 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-methoxyethyl]-3-[[1-(methylamino)cyclobutyl]methyl]urea |
| SMILES | CNC1(CNC(=O)NCC(OC)c2cccc(Cl)c2)CCC1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-18-16(7-4-8-16)11-20-15(21)19-10-14(22-2)12-5-3-6-13(17)9-12/h3,5-6,9,14,18H,4,7-8,10-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | WZAOUUKNMXUEKL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |