C25H31N3O2 — CID 72663582
N-hydroxy-2-phenyl-3-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]cyclopropane-1-carboxamide (PubChem CID 72663582) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-hydroxy-2-phenyl-3-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-hydroxy-2-phenyl-3-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 72663582 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-hydroxy-2-phenyl-3-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NO)C1C(c2ccccc2)C1c1cccc(N2CCC(N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C25H31N3O2/c29-25(26-30)24-22(18-7-2-1-3-8-18)23(24)19-9-6-10-21(17-19)28-15-11-20(12-16-28)27-13-4-5-14-27/h1-3,6-10,17,20,22-24,30H,4-5,11-16H2,(H,26,29) |
| InChIKey | ABYADMUFPHKZIY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|