C18H25N5 — CID 68943222
4-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazol-5-amine (PubChem CID 68943222) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 68943222 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 4-[3-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1cccc(N2CCC(N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C18H25N5/c19-18-17(13-20-21-18)14-4-3-5-16(12-14)23-10-6-15(7-11-23)22-8-1-2-9-22/h3-5,12-13,15H,1-2,6-11H2,(H3,19,20,21) |
| InChIKey | KSINXUKMVSGXEW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |