C14H19N5 — CID 68700957
4-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-5-amine (PubChem CID 68700957) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 68700957 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazol-5-amine |
| SMILES | CN1CCN(c2cccc(-c3cn[nH]c3N)c2)CC1 |
| InChI | InChI=1S/C14H19N5/c1-18-5-7-19(8-6-18)12-4-2-3-11(9-12)13-10-16-17-14(13)15/h2-4,9-10H,5-8H2,1H3,(H3,15,16,17) |
| InChIKey | OHYJKSRUTDPEEB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |