C19H20Cl2N4O — CID 162690728
(1S,4R,5S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-(3,5-dichlorophenyl)-2-azabicyclo[3.1.0]hexane-4-carboxamide (PubChem CID 162690728) has the molecular formula C19H20Cl2N4O and a molecular weight of 391.30 g/mol. Its IUPAC name is (1S,4R,5S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-(3,5-dichlorophenyl)-2-azabicyclo[3.1.0]hexane-4-carboxamide.
| Compound Name | (1S,4R,5S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-(3,5-dichlorophenyl)-2-azabicyclo[3.1.0]hexane-4-carboxamide |
|---|---|
| PubChem CID | 162690728 |
| Molecular Formula | C19H20Cl2N4O |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (1S,4R,5S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-(3,5-dichlorophenyl)-2-azabicyclo[3.1.0]hexane-4-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)[C@H]1CN(c3cc(Cl)cc(Cl)c3)[C@H]3C[C@@H]13)C2 |
| InChI | InChI=1S/C19H20Cl2N4O/c20-10-3-11(21)5-13(4-10)24-8-15(14-7-18(14)24)19(26)23-16-6-12-1-2-17(16)25(12)9-22/h3-5,12,14-18H,1-2,6-8H2,(H,23,26)/t12-,14-,15-,16+,17+,18-/m0/s1 |
| InChIKey | AOALXRCVNUALNF-UJRAXUBMSA-N |
| XLogP | 3.02 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|