C23H21N5O2 — CID 162481849
N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 162481849) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162481849 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | N#CN1[C@@H]2CC[C@H]1[C@@H](NC(=O)c1cc(-c3ccccc3Oc3ccccc3)n[nH]1)C2 |
| InChI | InChI=1S/C23H21N5O2/c24-14-28-15-10-11-21(28)19(12-15)25-23(29)20-13-18(26-27-20)17-8-4-5-9-22(17)30-16-6-2-1-3-7-16/h1-9,13,15,19,21H,10-12H2,(H,25,29)(H,26,27)/t15-,19+,21+/m1/s1 |
| InChIKey | WFXYHBOCRFLCDI-JJXUHFIVSA-N |
| XLogP | 3.69 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|