C23H19N5O2 — CID 163744423
N-[(4S)-2-cyano-2-azatricyclo[3.1.1.01,5]heptan-4-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 163744423) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[(4S)-2-cyano-2-azatricyclo[3.1.1.01,5]heptan-4-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(4S)-2-cyano-2-azatricyclo[3.1.1.01,5]heptan-4-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 163744423 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[(4S)-2-cyano-2-azatricyclo[3.1.1.01,5]heptan-4-yl]-3-(2-phenoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | N#CN1C[C@@H](NC(=O)c2cc(-c3ccccc3Oc3ccccc3)n[nH]2)C23CC12C3 |
| InChI | InChI=1S/C23H19N5O2/c24-14-28-11-20(22-12-23(22,28)13-22)25-21(29)18-10-17(26-27-18)16-8-4-5-9-19(16)30-15-6-2-1-3-7-15/h1-10,20H,11-13H2,(H,25,29)(H,26,27)/t20-,22?,23?/m1/s1 |
| InChIKey | LKPCPARGFAQNES-RDABAPPSSA-N |
| XLogP | 3.30 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|