C22H22N6O2 — CID 166843442
N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-(4-phenoxy-3-pyridinyl)-1H-pyrazole-5-carboxamide (PubChem CID 166843442) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-(4-phenoxy-3-pyridinyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-(4-phenoxy-3-pyridinyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166843442 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[(3R)-1-cyano-2,4-dimethylpyrrolidin-3-yl]-3-(4-phenoxy-3-pyridinyl)-1H-pyrazole-5-carboxamide |
| SMILES | CC1CN(C#N)C(C)[C@@H]1NC(=O)c1cc(-c2cnccc2Oc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C22H22N6O2/c1-14-12-28(13-23)15(2)21(14)25-22(29)19-10-18(26-27-19)17-11-24-9-8-20(17)30-16-6-4-3-5-7-16/h3-11,14-15,21H,12H2,1-2H3,(H,25,29)(H,26,27)/t14?,15?,21-/m1/s1 |
| InChIKey | COVNYLFUDLCPSB-ZGDBYOLNSA-N |
| XLogP | 3.18 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|