C24H22N4O2 — CID 163621658
(1S,5S)-1-[2-oxo-2-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]ethyl]-3-azabicyclo[3.2.0]heptane-3-carbonitrile (PubChem CID 163621658) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is (1S,5S)-1-[2-oxo-2-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]ethyl]-3-azabicyclo[3.2.0]heptane-3-carbonitrile.
| Compound Name | (1S,5S)-1-[2-oxo-2-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]ethyl]-3-azabicyclo[3.2.0]heptane-3-carbonitrile |
|---|---|
| PubChem CID | 163621658 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (1S,5S)-1-[2-oxo-2-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]ethyl]-3-azabicyclo[3.2.0]heptane-3-carbonitrile |
| SMILES | N#CN1C[C@H]2CC[C@@]2(CC(=O)c2cc(-c3ccccc3Oc3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C24H22N4O2/c25-16-28-14-17-10-11-24(17,15-28)13-22(29)21-12-20(26-27-21)19-8-4-5-9-23(19)30-18-6-2-1-3-7-18/h1-9,12,17H,10-11,13-15H2,(H,26,27)/t17-,24-/m1/s1 |
| InChIKey | HOPWPHNFJLNMBC-MZNJEOGPSA-N |
| XLogP | 4.63 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|