C31H39N7O3 — CID 59087190
(2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-oxo-2-[4-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]acetamide (PubChem CID 59087190) has the molecular formula C31H39N7O3 and a molecular weight of 557.70 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-oxo-2-[4-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]acetamide.
| Compound Name | (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-oxo-2-[4-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 59087190 |
| Molecular Formula | C31H39N7O3 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-oxo-2-[4-[3-(2-phenoxyphenyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethyl]acetamide |
| SMILES | NC(N)=N[C@@H](C(=O)NCC(=O)N1CCC(c2cc(-c3ccccc3Oc3ccccc3)n[nH]2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C31H39N7O3/c32-31(33)35-29(22-9-3-1-4-10-22)30(40)34-20-28(39)38-17-15-21(16-18-38)25-19-26(37-36-25)24-13-7-8-14-27(24)41-23-11-5-2-6-12-23/h2,5-8,11-14,19,21-22,29H,1,3-4,9-10,15-18,20H2,(H,34,40)(H,36,37)(H4,32,33,35)/t29-/m1/s1 |
| InChIKey | BLYRQBXTRQCZGW-GDLZYMKVSA-N |
| XLogP | 3.91 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|