C21H25N7O2S — CID 142256642
N-[2-[4-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide (PubChem CID 142256642) has the molecular formula C21H25N7O2S and a molecular weight of 439.55 g/mol. Its IUPAC name is N-[2-[4-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide.
| Compound Name | N-[2-[4-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide |
|---|---|
| PubChem CID | 142256642 |
| Molecular Formula | C21H25N7O2S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[2-[4-[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide |
| SMILES | NC(N)=NCC(=O)NCC(=O)N1CCC(c2cc(-c3csc4ccccc34)n[nH]2)CC1 |
| InChI | InChI=1S/C21H25N7O2S/c22-21(23)25-10-19(29)24-11-20(30)28-7-5-13(6-8-28)16-9-17(27-26-16)15-12-31-18-4-2-1-3-14(15)18/h1-4,9,12-13H,5-8,10-11H2,(H,24,29)(H,26,27)(H4,22,23,25) |
| InChIKey | VFWLXSRHFNGGRR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|