C25H34ClN7O3 — CID 142256631
N-[2-[4-[3-[2-chloro-4-(cyclopentylmethoxy)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide (PubChem CID 142256631) has the molecular formula C25H34ClN7O3 and a molecular weight of 516.05 g/mol. Its IUPAC name is N-[2-[4-[3-[2-chloro-4-(cyclopentylmethoxy)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide.
| Compound Name | N-[2-[4-[3-[2-chloro-4-(cyclopentylmethoxy)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide |
|---|---|
| PubChem CID | 142256631 |
| Molecular Formula | C25H34ClN7O3 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[2-[4-[3-[2-chloro-4-(cyclopentylmethoxy)phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-(diaminomethylideneamino)acetamide |
| SMILES | NC(N)=NCC(=O)NCC(=O)N1CCC(c2cc(-c3ccc(OCC4CCCC4)cc3Cl)n[nH]2)CC1 |
| InChI | InChI=1S/C25H34ClN7O3/c26-20-11-18(36-15-16-3-1-2-4-16)5-6-19(20)22-12-21(31-32-22)17-7-9-33(10-8-17)24(35)14-29-23(34)13-30-25(27)28/h5-6,11-12,16-17H,1-4,7-10,13-15H2,(H,29,34)(H,31,32)(H4,27,28,30) |
| InChIKey | JJWGBHQBZYOXOB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|