C31H37Cl3N8O3 — CID 59087225
(2R)-N-[2-[4-[3-[2-chloro-4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-cyclohexyl-2-(diaminomethylideneamino)acetamide (PubChem CID 59087225) has the molecular formula C31H37Cl3N8O3 and a molecular weight of 676.05 g/mol. Its IUPAC name is (2R)-N-[2-[4-[3-[2-chloro-4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-cyclohexyl-2-(diaminomethylideneamino)acetamide.
| Compound Name | (2R)-N-[2-[4-[3-[2-chloro-4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-cyclohexyl-2-(diaminomethylideneamino)acetamide |
|---|---|
| PubChem CID | 59087225 |
| Molecular Formula | C31H37Cl3N8O3 |
| Molecular Weight | 676.05 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | (2R)-N-[2-[4-[3-[2-chloro-4-[(2,6-dichloro-4-pyridinyl)methoxy]phenyl]-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]-2-cyclohexyl-2-(diaminomethylideneamino)acetamide |
| SMILES | NC(N)=N[C@@H](C(=O)NCC(=O)N1CCC(c2cc(-c3ccc(OCc4cc(Cl)nc(Cl)c4)cc3Cl)n[nH]2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C31H37Cl3N8O3/c32-23-14-21(45-17-18-12-26(33)38-27(34)13-18)6-7-22(23)25-15-24(40-41-25)19-8-10-42(11-9-19)28(43)16-37-30(44)29(39-31(35)36)20-4-2-1-3-5-20/h6-7,12-15,19-20,29H,1-5,8-11,16-17H2,(H,37,44)(H,40,41)(H4,35,36,39)/t29-/m1/s1 |
| InChIKey | HQAMSKAUVNYYLS-GDLZYMKVSA-N |
| XLogP | 5.06 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.05 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|