C26H36Cl2N8O2 — CID 59087198
(2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]-1,4-diazepan-1-yl]-2-oxoethyl]acetamide (PubChem CID 59087198) has the molecular formula C26H36Cl2N8O2 and a molecular weight of 563.53 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]-1,4-diazepan-1-yl]-2-oxoethyl]acetamide.
| Compound Name | (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]-1,4-diazepan-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 59087198 |
| Molecular Formula | C26H36Cl2N8O2 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]-1,4-diazepan-1-yl]-2-oxoethyl]acetamide |
| SMILES | Cn1nc(-c2cccc(Cl)c2Cl)cc1N1CCCN(C(=O)CNC(=O)[C@H](N=C(N)N)C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H36Cl2N8O2/c1-34-21(15-20(33-34)18-9-5-10-19(27)23(18)28)35-11-6-12-36(14-13-35)22(37)16-31-25(38)24(32-26(29)30)17-7-3-2-4-8-17/h5,9-10,15,17,24H,2-4,6-8,11-14,16H2,1H3,(H,31,38)(H4,29,30,32)/t24-/m1/s1 |
| InChIKey | ZNCNAZWJSMSBNI-XMMPIXPASA-N |
| XLogP | 2.77 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|