C25H34Cl2N8O2 — CID 59087159
(2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]piperazin-1-yl]-2-oxoethyl]acetamide (PubChem CID 59087159) has the molecular formula C25H34Cl2N8O2 and a molecular weight of 549.51 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]piperazin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]piperazin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 59087159 |
| Molecular Formula | C25H34Cl2N8O2 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | (2R)-2-cyclohexyl-2-(diaminomethylideneamino)-N-[2-[4-[3-(2,3-dichlorophenyl)-1-methylpyrazol-5-yl]piperazin-1-yl]-2-oxoethyl]acetamide |
| SMILES | Cn1nc(-c2cccc(Cl)c2Cl)cc1N1CCN(C(=O)CNC(=O)[C@H](N=C(N)N)C2CCCCC2)CC1 |
| InChI | InChI=1S/C25H34Cl2N8O2/c1-33-20(14-19(32-33)17-8-5-9-18(26)22(17)27)34-10-12-35(13-11-34)21(36)15-30-24(37)23(31-25(28)29)16-6-3-2-4-7-16/h5,8-9,14,16,23H,2-4,6-7,10-13,15H2,1H3,(H,30,37)(H4,28,29,31)/t23-/m1/s1 |
| InChIKey | VXMXXUGNMODMHN-HSZRJFAPSA-N |
| XLogP | 2.38 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|