C23H23Cl2N5O — CID 23530948
3-[2-[4-[3-(2,3-dichlorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzenecarboximidamide (PubChem CID 23530948) has the molecular formula C23H23Cl2N5O and a molecular weight of 456.38 g/mol. Its IUPAC name is 3-[2-[4-[3-(2,3-dichlorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzenecarboximidamide.
| Compound Name | 3-[2-[4-[3-(2,3-dichlorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 23530948 |
| Molecular Formula | C23H23Cl2N5O |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 3-[2-[4-[3-(2,3-dichlorophenyl)-1H-pyrazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CC(=O)N2CCC(c3cc(-c4cccc(Cl)c4Cl)n[nH]3)CC2)c1 |
| InChI | InChI=1S/C23H23Cl2N5O/c24-18-6-2-5-17(22(18)25)20-13-19(28-29-20)15-7-9-30(10-8-15)21(31)12-14-3-1-4-16(11-14)23(26)27/h1-6,11,13,15H,7-10,12H2,(H3,26,27)(H,28,29) |
| InChIKey | IIWDLWQOEZASNU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|