C23H21N5O2 — CID 146463140
(1R,5S)-2-[3-(2-phenoxyphenyl)-1H-pyrazole-5-carbonyl]-2,6-diazabicyclo[3.2.1]octane-6-carbonitrile (PubChem CID 146463140) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is (1R,5S)-2-[3-(2-phenoxyphenyl)-1H-pyrazole-5-carbonyl]-2,6-diazabicyclo[3.2.1]octane-6-carbonitrile.
| Compound Name | (1R,5S)-2-[3-(2-phenoxyphenyl)-1H-pyrazole-5-carbonyl]-2,6-diazabicyclo[3.2.1]octane-6-carbonitrile |
|---|---|
| PubChem CID | 146463140 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (1R,5S)-2-[3-(2-phenoxyphenyl)-1H-pyrazole-5-carbonyl]-2,6-diazabicyclo[3.2.1]octane-6-carbonitrile |
| SMILES | N#CN1C[C@H]2C[C@@H]1CCN2C(=O)c1cc(-c2ccccc2Oc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C23H21N5O2/c24-15-27-14-17-12-16(27)10-11-28(17)23(29)21-13-20(25-26-21)19-8-4-5-9-22(19)30-18-6-2-1-3-7-18/h1-9,13,16-17H,10-12,14H2,(H,25,26)/t16-,17+/m0/s1 |
| InChIKey | PMTCGWBSBBSCSF-DLBZAZTESA-N |
| XLogP | 3.64 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|