C15H14ClN3O3 — CID 119356183
1-[3-(2-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 119356183) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-(2-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119356183 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-[3-(2-chlorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C(=O)c1cc(-c2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C15H14ClN3O3/c16-10-5-2-1-4-9(10)11-8-12(18-17-11)14(20)19-7-3-6-13(19)15(21)22/h1-2,4-5,8,13H,3,6-7H2,(H,17,18)(H,21,22) |
| InChIKey | JVMFNLUXIYMCDA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |