C14H15ClN4O — CID 64524062
(3-amino-1H-pyrazol-5-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 64524062) has the molecular formula C14H15ClN4O and a molecular weight of 290.75 g/mol. Its IUPAC name is (3-amino-1H-pyrazol-5-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-amino-1H-pyrazol-5-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 64524062 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (3-amino-1H-pyrazol-5-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | Nc1cc(C(=O)N2CCCC2c2ccccc2Cl)[nH]n1 |
| InChI | InChI=1S/C14H15ClN4O/c15-10-5-2-1-4-9(10)12-6-3-7-19(12)14(20)11-8-13(16)18-17-11/h1-2,4-5,8,12H,3,6-7H2,(H3,16,17,18) |
| InChIKey | GOYWBMQNBQRGTG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |