C18H16ClN3O — CID 97313577
[(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone (PubChem CID 97313577) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is [(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone.
| Compound Name | [(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 97313577 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [(2R)-2-(2-chlorophenyl)pyrrolidin-1-yl]-(1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CCC[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C18H16ClN3O/c19-14-8-3-1-6-12(14)16-10-5-11-22(16)18(23)17-13-7-2-4-9-15(13)20-21-17/h1-4,6-9,16H,5,10-11H2,(H,20,21)/t16-/m1/s1 |
| InChIKey | WORQUPYGFYSVSM-MRXNPFEDSA-N |
| XLogP | 4.19 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |