C15H17ClN4O — CID 62081247
(4-amino-5-methyl-1H-pyrazol-3-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 62081247) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is (4-amino-5-methyl-1H-pyrazol-3-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-amino-5-methyl-1H-pyrazol-3-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 62081247 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (4-amino-5-methyl-1H-pyrazol-3-yl)-[2-(2-chlorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1[nH]nc(C(=O)N2CCCC2c2ccccc2Cl)c1N |
| InChI | InChI=1S/C15H17ClN4O/c1-9-13(17)14(19-18-9)15(21)20-8-4-7-12(20)10-5-2-3-6-11(10)16/h2-3,5-6,12H,4,7-8,17H2,1H3,(H,18,19) |
| InChIKey | NDWPTPRXHLTSRT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |