C16H14Cl2N2O — CID 81228562
[2-(2-chlorophenyl)pyrrolidin-1-yl]-(4-chloro-3-pyridinyl)methanone (PubChem CID 81228562) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is [2-(2-chlorophenyl)pyrrolidin-1-yl]-(4-chloro-3-pyridinyl)methanone.
| Compound Name | [2-(2-chlorophenyl)pyrrolidin-1-yl]-(4-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 81228562 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [2-(2-chlorophenyl)pyrrolidin-1-yl]-(4-chloro-3-pyridinyl)methanone |
| SMILES | O=C(c1cnccc1Cl)N1CCCC1c1ccccc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O/c17-13-5-2-1-4-11(13)15-6-3-9-20(15)16(21)12-10-19-8-7-14(12)18/h1-2,4-5,7-8,10,15H,3,6,9H2 |
| InChIKey | NPIIEFYLXJOELO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |