C17H15ClINO — CID 63524414
[2-(2-chlorophenyl)pyrrolidin-1-yl]-(3-iodophenyl)methanone (PubChem CID 63524414) has the molecular formula C17H15ClINO and a molecular weight of 411.67 g/mol. Its IUPAC name is [2-(2-chlorophenyl)pyrrolidin-1-yl]-(3-iodophenyl)methanone.
| Compound Name | [2-(2-chlorophenyl)pyrrolidin-1-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 63524414 |
| Molecular Formula | C17H15ClINO |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | [2-(2-chlorophenyl)pyrrolidin-1-yl]-(3-iodophenyl)methanone |
| SMILES | O=C(c1cccc(I)c1)N1CCCC1c1ccccc1Cl |
| InChI | InChI=1S/C17H15ClINO/c18-15-8-2-1-7-14(15)16-9-4-10-20(16)17(21)12-5-3-6-13(19)11-12/h1-3,5-8,11,16H,4,9-10H2 |
| InChIKey | HAZVPIRGYHVYBU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|