C25H24N4O2 — CID 167261398
N-[(3R)-1-cyano-3,4-dimethylpyrrolidin-3-yl]-4-(4-phenoxy-3-pyridinyl)benzamide (PubChem CID 167261398) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[(3R)-1-cyano-3,4-dimethylpyrrolidin-3-yl]-4-(4-phenoxy-3-pyridinyl)benzamide.
| Compound Name | N-[(3R)-1-cyano-3,4-dimethylpyrrolidin-3-yl]-4-(4-phenoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 167261398 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[(3R)-1-cyano-3,4-dimethylpyrrolidin-3-yl]-4-(4-phenoxy-3-pyridinyl)benzamide |
| SMILES | CC1CN(C#N)C[C@]1(C)NC(=O)c1ccc(-c2cnccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-18-15-29(17-26)16-25(18,2)28-24(30)20-10-8-19(9-11-20)22-14-27-13-12-23(22)31-21-6-4-3-5-7-21/h3-14,18H,15-16H2,1-2H3,(H,28,30)/t18?,25-/m0/s1 |
| InChIKey | CCRVJZRVBZZUGU-LYIYLXCWSA-N |
| XLogP | 4.46 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|