C25H24FN5O — CID 170053467
N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-4-[3-[(4-fluorocyclohexa-1,3-dien-1-yl)amino]-4-pyridinyl]benzamide (PubChem CID 170053467) has the molecular formula C25H24FN5O and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-4-[3-[(4-fluorocyclohexa-1,3-dien-1-yl)amino]-4-pyridinyl]benzamide.
| Compound Name | N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-4-[3-[(4-fluorocyclohexa-1,3-dien-1-yl)amino]-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 170053467 |
| Molecular Formula | C25H24FN5O |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-4-[3-[(4-fluorocyclohexa-1,3-dien-1-yl)amino]-4-pyridinyl]benzamide |
| SMILES | N#CN1CC2CC[C@]2(NC(=O)c2ccc(-c3ccncc3NC3=CC=C(F)CC3)cc2)C1 |
| InChI | InChI=1S/C25H24FN5O/c26-20-5-7-21(8-6-20)29-23-13-28-12-10-22(23)17-1-3-18(4-2-17)24(32)30-25-11-9-19(25)14-31(15-25)16-27/h1-5,7,10,12-13,19,29H,6,8-9,11,14-15H2,(H,30,32)/t19?,25-/m0/s1 |
| InChIKey | UWBRWFDHDWSLKL-BIAFCPFJSA-N |
| XLogP | 4.37 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|