C23H19FN4OS2 — CID 162481813
N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-5-[2-(4-fluorophenyl)sulfanylphenyl]-1,3-thiazole-2-carboxamide (PubChem CID 162481813) has the molecular formula C23H19FN4OS2 and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-5-[2-(4-fluorophenyl)sulfanylphenyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-5-[2-(4-fluorophenyl)sulfanylphenyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 162481813 |
| Molecular Formula | C23H19FN4OS2 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[(1R)-3-cyano-3-azabicyclo[3.2.0]heptan-1-yl]-5-[2-(4-fluorophenyl)sulfanylphenyl]-1,3-thiazole-2-carboxamide |
| SMILES | N#CN1CC2CC[C@]2(NC(=O)c2ncc(-c3ccccc3Sc3ccc(F)cc3)s2)C1 |
| InChI | InChI=1S/C23H19FN4OS2/c24-16-5-7-17(8-6-16)30-19-4-2-1-3-18(19)20-11-26-22(31-20)21(29)27-23-10-9-15(23)12-28(13-23)14-25/h1-8,11,15H,9-10,12-13H2,(H,27,29)/t15?,23-/m0/s1 |
| InChIKey | SIZQMZZTZQZWBY-GMTBNIFVSA-N |
| XLogP | 4.78 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|