C24H23N5O2 — CID 166843398
N-(3-cyano-3-azabicyclo[3.1.0]hexan-1-yl)-3-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide (PubChem CID 166843398) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-(3-cyano-3-azabicyclo[3.1.0]hexan-1-yl)-3-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-(3-cyano-3-azabicyclo[3.1.0]hexan-1-yl)-3-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166843398 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(3-cyano-3-azabicyclo[3.1.0]hexan-1-yl)-3-[2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide |
| SMILES | C=C/C=C\C=C(/C=C)Oc1ccccc1-c1cc(C(=O)NC23CC2CN(C#N)C3)[nH]n1 |
| InChI | InChI=1S/C24H23N5O2/c1-3-5-6-9-18(4-2)31-22-11-8-7-10-19(22)20-12-21(28-27-20)23(30)26-24-13-17(24)14-29(15-24)16-25/h3-12,17H,1-2,13-15H2,(H,26,30)(H,27,28)/b6-5-,18-9+ |
| InChIKey | TXWDSQWZAUWEPY-LQMIUDCDSA-N |
| XLogP | 3.55 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|