C17H17N3O2 — CID 166843472
3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide (PubChem CID 166843472) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166843472 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-1H-pyrazole-5-carboxamide |
| SMILES | C=C/C(=C\C=C/C)Oc1ccccc1-c1cc(C(N)=O)[nH]n1 |
| InChI | InChI=1S/C17H17N3O2/c1-3-5-8-12(4-2)22-16-10-7-6-9-13(16)14-11-15(17(18)21)20-19-14/h3-11H,2H2,1H3,(H2,18,21)(H,19,20)/b5-3-,12-8+ |
| InChIKey | HFIZCUGFPBNUSU-VRMADBIASA-N |
| XLogP | 3.20 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|