C22H19N5OS — CID 162481923
N-[(1R)-3-cyano-3-azabicyclo[3.1.0]hexan-1-yl]-3-(2-phenylsulfanylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 162481923) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[(1R)-3-cyano-3-azabicyclo[3.1.0]hexan-1-yl]-3-(2-phenylsulfanylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(1R)-3-cyano-3-azabicyclo[3.1.0]hexan-1-yl]-3-(2-phenylsulfanylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 162481923 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[(1R)-3-cyano-3-azabicyclo[3.1.0]hexan-1-yl]-3-(2-phenylsulfanylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | N#CN1CC2C[C@]2(NC(=O)c2cc(-c3ccccc3Sc3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C22H19N5OS/c23-14-27-12-15-11-22(15,13-27)24-21(28)19-10-18(25-26-19)17-8-4-5-9-20(17)29-16-6-2-1-3-7-16/h1-10,15H,11-13H2,(H,24,28)(H,25,26)/t15?,22-/m0/s1 |
| InChIKey | PQJLGHRDCPKTDP-CEISFSOZSA-N |
| XLogP | 3.51 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|