C26H24FN3OS — CID 170052468
(1R)-1-[[[4-[2-(4-fluorophenyl)sulfanylphenyl]phenyl]-hydroxymethyl]amino]-3-azabicyclo[3.2.0]heptane-3-carbonitrile (PubChem CID 170052468) has the molecular formula C26H24FN3OS and a molecular weight of 445.56 g/mol. Its IUPAC name is (1R)-1-[[[4-[2-(4-fluorophenyl)sulfanylphenyl]phenyl]-hydroxymethyl]amino]-3-azabicyclo[3.2.0]heptane-3-carbonitrile.
| Compound Name | (1R)-1-[[[4-[2-(4-fluorophenyl)sulfanylphenyl]phenyl]-hydroxymethyl]amino]-3-azabicyclo[3.2.0]heptane-3-carbonitrile |
|---|---|
| PubChem CID | 170052468 |
| Molecular Formula | C26H24FN3OS |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (1R)-1-[[[4-[2-(4-fluorophenyl)sulfanylphenyl]phenyl]-hydroxymethyl]amino]-3-azabicyclo[3.2.0]heptane-3-carbonitrile |
| SMILES | N#CN1CC2CC[C@]2(NC(O)c2ccc(-c3ccccc3Sc3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C26H24FN3OS/c27-21-9-11-22(12-10-21)32-24-4-2-1-3-23(24)18-5-7-19(8-6-18)25(31)29-26-14-13-20(26)15-30(16-26)17-28/h1-12,20,25,29,31H,13-16H2/t20?,25?,26-/m0/s1 |
| InChIKey | VZDKEEJYFUPSST-GMLZKYASSA-N |
| XLogP | 5.17 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|