C21H15N5OS2 — CID 170053545
N-(3-cyano-3-azatricyclo[3.1.0.02,6]hexan-5-yl)-5-(4-phenylsulfanyl-3-pyridinyl)-1,3-thiazole-2-carboxamide (PubChem CID 170053545) has the molecular formula C21H15N5OS2 and a molecular weight of 417.52 g/mol. Its IUPAC name is N-(3-cyano-3-azatricyclo[3.1.0.02,6]hexan-5-yl)-5-(4-phenylsulfanyl-3-pyridinyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(3-cyano-3-azatricyclo[3.1.0.02,6]hexan-5-yl)-5-(4-phenylsulfanyl-3-pyridinyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 170053545 |
| Molecular Formula | C21H15N5OS2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | N-(3-cyano-3-azatricyclo[3.1.0.02,6]hexan-5-yl)-5-(4-phenylsulfanyl-3-pyridinyl)-1,3-thiazole-2-carboxamide |
| SMILES | N#CN1CC2(NC(=O)c3ncc(-c4cnccc4Sc4ccccc4)s3)C3C1C32 |
| InChI | InChI=1S/C21H15N5OS2/c22-11-26-10-21(16-17(21)18(16)26)25-19(27)20-24-9-15(29-20)13-8-23-7-6-14(13)28-12-4-2-1-3-5-12/h1-9,16-18H,10H2,(H,25,27) |
| InChIKey | ACOKRWSZFIUFBW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|