C9H6N2O2S — CID 22709467
5-pyridin-4-yl-1,3-thiazole-2-carboxylic acid (PubChem CID 22709467) has the molecular formula C9H6N2O2S and a molecular weight of 206.23 g/mol. Its IUPAC name is 5-pyridin-4-yl-1,3-thiazole-2-carboxylic acid.
| Compound Name | 5-pyridin-4-yl-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 22709467 |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 5-pyridin-4-yl-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(-c2ccncc2)s1 |
| InChI | InChI=1S/C9H6N2O2S/c12-9(13)8-11-5-7(14-8)6-1-3-10-4-2-6/h1-5H,(H,12,13) |
| InChIKey | CRTKTHURRXSBLH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |