methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid

C10H9N3O2S — CID 69177329

IUPACmethyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid
SMILESCN(C(=O)O)c1ncc(-c2ccncc2)s1
InChIInChI=1S/C10H9N3O2S/c1-13(10(14)15)9-12-6-8(16-9)7-2-4-11-5-3-7/h2-6H,1H3,(H,14,15)
InChIKeyGZSAEPHGFYNLAV-UHFFFAOYSA-N
MW235.27 g/mol
LogP2.32
Rot. Bonds2

About methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid

methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid (PubChem CID 69177329) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid.

Molecular Properties

Compound Namemethyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid
PubChem CID69177329
Molecular FormulaC10H9N3O2S
Molecular Weight235.27 g/mol
Exact Mass235.04
IUPAC Namemethyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid
SMILESCN(C(=O)O)c1ncc(-c2ccncc2)s1
InChIInChI=1S/C10H9N3O2S/c1-13(10(14)15)9-12-6-8(16-9)7-2-4-11-5-3-7/h2-6H,1H3,(H,14,15)
InChIKeyGZSAEPHGFYNLAV-UHFFFAOYSA-N
XLogP2.32
TPSA66.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.27
LogP ≤ 52.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid?
The IUPAC name of methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid (CID 69177329) is methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid.
What is the SMILES notation for methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid?
The canonical SMILES for methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid is CN(C(=O)O)c1ncc(-c2ccncc2)s1.
What is the InChIKey of methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid?
The InChIKey is GZSAEPHGFYNLAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2S/c1-13(10(14)15)9-12-6-8(16-9)7-2-4-11-5-3-7/h2-6H,1H3,(H,14,15).
What are the key properties of methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid?
methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid has a molecular weight of 235.27 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(5-pyridin-4-yl-1,3-thiazol-2-yl)carbamic acid is sourced from PubChem (CID 69177329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).