C9H10N4S — CID 142305016
1-methyl-1-(5-pyridin-3-yl-1,3-thiazol-2-yl)hydrazine (PubChem CID 142305016) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 1-methyl-1-(5-pyridin-3-yl-1,3-thiazol-2-yl)hydrazine.
| Compound Name | 1-methyl-1-(5-pyridin-3-yl-1,3-thiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 142305016 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 1-methyl-1-(5-pyridin-3-yl-1,3-thiazol-2-yl)hydrazine |
| SMILES | CN(N)c1ncc(-c2cccnc2)s1 |
| InChI | InChI=1S/C9H10N4S/c1-13(10)9-12-6-8(14-9)7-3-2-4-11-5-7/h2-6H,10H2,1H3 |
| InChIKey | CXBOSFJZBZDULX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|