C12H12N2O2S2 — CID 123657226
N-methyl-N-(5-methylsulfinyl-1,3-thiazol-2-yl)benzamide (PubChem CID 123657226) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-methyl-N-(5-methylsulfinyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-methyl-N-(5-methylsulfinyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 123657226 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N-methyl-N-(5-methylsulfinyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CN(C(=O)c1ccccc1)c1ncc(S(C)=O)s1 |
| InChI | InChI=1S/C12H12N2O2S2/c1-14(11(15)9-6-4-3-5-7-9)12-13-8-10(17-12)18(2)16/h3-8H,1-2H3 |
| InChIKey | VLFUGKIMSHMAME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |