C16H12BrN3OS — CID 108741998
N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylbenzamide (PubChem CID 108741998) has the molecular formula C16H12BrN3OS and a molecular weight of 374.26 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylbenzamide.
| Compound Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 108741998 |
| Molecular Formula | C16H12BrN3OS |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1)c1nnc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C16H12BrN3OS/c1-20(15(21)12-5-3-2-4-6-12)16-19-18-14(22-16)11-7-9-13(17)10-8-11/h2-10H,1H3 |
| InChIKey | FHAKDEZBYPTSLM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |