C14H16BrN3O2S — CID 108742018
butyl N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylcarbamate (PubChem CID 108742018) has the molecular formula C14H16BrN3O2S and a molecular weight of 370.27 g/mol. Its IUPAC name is butyl N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylcarbamate.
| Compound Name | butyl N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 108742018 |
| Molecular Formula | C14H16BrN3O2S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | butyl N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)c1nnc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C14H16BrN3O2S/c1-3-4-9-20-14(19)18(2)13-17-16-12(21-13)10-5-7-11(15)8-6-10/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | OKXSMEJHISPHRN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|