C16H9BrF3N3OS — CID 108742002
N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-2,3,4-trifluoro-N-methylbenzamide (PubChem CID 108742002) has the molecular formula C16H9BrF3N3OS and a molecular weight of 428.23 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-2,3,4-trifluoro-N-methylbenzamide.
| Compound Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-2,3,4-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 108742002 |
| Molecular Formula | C16H9BrF3N3OS |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-2,3,4-trifluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(F)c(F)c1F)c1nnc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C16H9BrF3N3OS/c1-23(15(24)10-6-7-11(18)13(20)12(10)19)16-22-21-14(25-16)8-2-4-9(17)5-3-8/h2-7H,1H3 |
| InChIKey | GFRKMCWOKHBRTK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|