C21H22BrN3O2S — CID 108764568
N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-4-(4-ethylphenoxy)-N-methylbutanamide (PubChem CID 108764568) has the molecular formula C21H22BrN3O2S and a molecular weight of 460.40 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-4-(4-ethylphenoxy)-N-methylbutanamide.
| Compound Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-4-(4-ethylphenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 108764568 |
| Molecular Formula | C21H22BrN3O2S |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-4-(4-ethylphenoxy)-N-methylbutanamide |
| SMILES | CCc1ccc(OCCCC(=O)N(C)c2nnc(-c3ccc(Br)cc3)s2)cc1 |
| InChI | InChI=1S/C21H22BrN3O2S/c1-3-15-6-12-18(13-7-15)27-14-4-5-19(26)25(2)21-24-23-20(28-21)16-8-10-17(22)11-9-16/h6-13H,3-5,14H2,1-2H3 |
| InChIKey | FXMYWMOCVKIKIU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|