C20H18BrN3O3S — CID 108764529
(E)-N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide (PubChem CID 108764529) has the molecular formula C20H18BrN3O3S and a molecular weight of 460.35 g/mol. Its IUPAC name is (E)-N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 108764529 |
| Molecular Formula | C20H18BrN3O3S |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | (E)-N-[5-(4-bromophenyl)-1,3,4-thiadiazol-2-yl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(C)c2nnc(-c3ccc(Br)cc3)s2)cc1OC |
| InChI | InChI=1S/C20H18BrN3O3S/c1-24(20-23-22-19(28-20)14-6-8-15(21)9-7-14)18(25)11-5-13-4-10-16(26-2)17(12-13)27-3/h4-12H,1-3H3/b11-5+ |
| InChIKey | WZMDDPYTNZHGEJ-VZUCSPMQSA-N |
| XLogP | 4.66 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|