C33H32BrNO5 — CID 21337208
(E)-N-[(4-bromophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]prop-2-enamide (PubChem CID 21337208) has the molecular formula C33H32BrNO5 and a molecular weight of 602.53 g/mol. Its IUPAC name is (E)-N-[(4-bromophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]prop-2-enamide.
| Compound Name | (E)-N-[(4-bromophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]prop-2-enamide |
|---|---|
| PubChem CID | 21337208 |
| Molecular Formula | C33H32BrNO5 |
| Molecular Weight | 602.53 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | (E)-N-[(4-bromophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methoxy]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(Cc2ccc(Br)cc2)OCc2ccc(OCc3ccc(C)cc3)cc2)cc1OC |
| InChI | InChI=1S/C33H32BrNO5/c1-24-4-6-27(7-5-24)22-39-30-16-10-28(11-17-30)23-40-35(21-26-8-14-29(34)15-9-26)33(36)19-13-25-12-18-31(37-2)32(20-25)38-3/h4-20H,21-23H2,1-3H3/b19-13+ |
| InChIKey | IJQXOBFKAVRGFM-CPNJWEJPSA-N |
| XLogP | 7.53 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.53 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|