C25H22BrNO5 — CID 6874053
[(E)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 6874053) has the molecular formula C25H22BrNO5 and a molecular weight of 496.36 g/mol. Its IUPAC name is [(E)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(E)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6874053 |
| Molecular Formula | C25H22BrNO5 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [(E)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)O/N=C/c2ccccc2OCc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C25H22BrNO5/c1-29-23-13-9-18(15-24(23)30-2)10-14-25(28)32-27-16-20-5-3-4-6-22(20)31-17-19-7-11-21(26)12-8-19/h3-16H,17H2,1-2H3/b14-10+,27-16+ |
| InChIKey | FRYQOGFDGJGWKV-ZUUNFTTNSA-N |
| XLogP | 5.64 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|