About (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate
(2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 19184950) has the molecular formula C24H21BrO4
and a molecular weight of 453.33 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate |
| PubChem CID | 19184950 |
| Molecular Formula | C24H21BrO4 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc(C)cc2Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H21BrO4/c1-17-8-11-21(20(25)14-17)29-24(26)13-10-18-9-12-22(23(15-18)27-2)28-16-19-6-4-3-5-7-19/h3-15H,16H2,1-2H3/b13-10+ |
| InChIKey | TZGPEKYPQIPTRP-JLHYYAGUSA-N |
| XLogP | 5.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate?
The IUPAC name of (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate (CID 19184950) is (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate.
What is the SMILES notation for (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate?
The canonical SMILES for (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate is COc1cc(/C=C/C(=O)Oc2ccc(C)cc2Br)ccc1OCc1ccccc1.
What is the InChIKey of (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate?
The InChIKey is TZGPEKYPQIPTRP-JLHYYAGUSA-N. The full InChI is InChI=1S/C24H21BrO4/c1-17-8-11-21(20(25)14-17)29-24(26)13-10-18-9-12-22(23(15-18)27-2)28-16-19-6-4-3-5-7-19/h3-15H,16H2,1-2H3/b13-10+.
What are the key properties of (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate?
(2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate has a molecular weight of 453.33 g/mol, XLogP of 5.96, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-methylphenyl) (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate is sourced from PubChem (CID 19184950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).