C16H11BrCl2O2 — CID 19177086
(2-bromo-4-methylphenyl) (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 19177086) has the molecular formula C16H11BrCl2O2 and a molecular weight of 386.07 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | (2-bromo-4-methylphenyl) (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19177086 |
| Molecular Formula | C16H11BrCl2O2 |
| Molecular Weight | 386.07 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | (2-bromo-4-methylphenyl) (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc(OC(=O)/C=C/c2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C16H11BrCl2O2/c1-10-2-6-15(12(17)8-10)21-16(20)7-4-11-3-5-13(18)14(19)9-11/h2-9H,1H3/b7-4+ |
| InChIKey | MAJOIXYBJRQKOQ-QPJJXVBHSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.07 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|