C20H20BrNO4 — CID 24529994
ethyl (E)-3-[4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]phenyl]prop-2-enoate (PubChem CID 24529994) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24529994 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | ethyl (E)-3-[4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)COc2ccc(C)cc2Br)cc1 |
| InChI | InChI=1S/C20H20BrNO4/c1-3-25-20(24)11-7-15-5-8-16(9-6-15)22-19(23)13-26-18-10-4-14(2)12-17(18)21/h4-12H,3,13H2,1-2H3,(H,22,23)/b11-7+ |
| InChIKey | UUYCXLHKEIGPKX-YRNVUSSQSA-N |
| XLogP | 4.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|