C23H25NO7 — CID 18282870
ethyl (E)-3-[4-[[2-[2-(2-methoxy-4-methylphenoxy)acetyl]oxyacetyl]amino]phenyl]prop-2-enoate (PubChem CID 18282870) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[2-[2-(2-methoxy-4-methylphenoxy)acetyl]oxyacetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[2-[2-(2-methoxy-4-methylphenoxy)acetyl]oxyacetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 18282870 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | ethyl (E)-3-[4-[[2-[2-(2-methoxy-4-methylphenoxy)acetyl]oxyacetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)COC(=O)COc2ccc(C)cc2OC)cc1 |
| InChI | InChI=1S/C23H25NO7/c1-4-29-22(26)12-8-17-6-9-18(10-7-17)24-21(25)14-31-23(27)15-30-19-11-5-16(2)13-20(19)28-3/h5-13H,4,14-15H2,1-3H3,(H,24,25)/b12-8+ |
| InChIKey | WBNQBYONSOJBSM-XYOKQWHBSA-N |
| XLogP | 3.14 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|