C26H24Br2N4O4 — CID 5087700
2-(2-bromo-4-methylphenoxy)-N-[[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide (PubChem CID 5087700) has the molecular formula C26H24Br2N4O4 and a molecular weight of 616.31 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5087700 |
| Molecular Formula | C26H24Br2N4O4 |
| Molecular Weight | 616.31 g/mol |
| Exact Mass | 614.02 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[[4-[[[2-(2-bromo-4-methylphenoxy)acetyl]hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(OCC(=O)NN=Cc2ccc(C=NNC(=O)COc3ccc(C)cc3Br)cc2)c(Br)c1 |
| InChI | InChI=1S/C26H24Br2N4O4/c1-17-3-9-23(21(27)11-17)35-15-25(33)31-29-13-19-5-7-20(8-6-19)14-30-32-26(34)16-36-24-10-4-18(2)12-22(24)28/h3-14H,15-16H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | SLNDTGQSRZTOGM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.31 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|