C17H15Br3N2O4 — CID 136791238
2-(2-bromo-4-methylphenoxy)-N-[(Z)-(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide (PubChem CID 136791238) has the molecular formula C17H15Br3N2O4 and a molecular weight of 551.03 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[(Z)-(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[(Z)-(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136791238 |
| Molecular Formula | C17H15Br3N2O4 |
| Molecular Weight | 551.03 g/mol |
| Exact Mass | 547.86 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[(Z)-(3,5-dibromo-2,4-dihydroxy-6-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(OCC(=O)N/N=C\c2c(C)c(Br)c(O)c(Br)c2O)c(Br)c1 |
| InChI | InChI=1S/C17H15Br3N2O4/c1-8-3-4-12(11(18)5-8)26-7-13(23)22-21-6-10-9(2)14(19)17(25)15(20)16(10)24/h3-6,24-25H,7H2,1-2H3,(H,22,23)/b21-6- |
| InChIKey | MHNTXCJXEYLHCW-MPUCSWFWSA-N |
| XLogP | 4.53 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.03 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|