C22H25BrO4 — CID 19221662
(2-bromo-4-methylphenyl) (E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoate (PubChem CID 19221662) has the molecular formula C22H25BrO4 and a molecular weight of 433.34 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) (E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoate.
| Compound Name | (2-bromo-4-methylphenyl) (E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19221662 |
| Molecular Formula | C22H25BrO4 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | (2-bromo-4-methylphenyl) (E)-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc(C)cc2Br)ccc1OCCC(C)C |
| InChI | InChI=1S/C22H25BrO4/c1-15(2)11-12-26-20-9-6-17(14-21(20)25-4)7-10-22(24)27-19-8-5-16(3)13-18(19)23/h5-10,13-15H,11-12H2,1-4H3/b10-7+ |
| InChIKey | ZALVNTKBFYZYMP-JXMROGBWSA-N |
| XLogP | 5.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|