C27H37NO3 — CID 3319250
N-[2,6-di(propan-2-yl)phenyl]-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide (PubChem CID 3319250) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3319250 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-3-[3-methoxy-4-(3-methylbutoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2c(C(C)C)cccc2C(C)C)ccc1OCCC(C)C |
| InChI | InChI=1S/C27H37NO3/c1-18(2)15-16-31-24-13-11-21(17-25(24)30-7)12-14-26(29)28-27-22(19(3)4)9-8-10-23(27)20(5)6/h8-14,17-20H,15-16H2,1-7H3,(H,28,29) |
| InChIKey | LOFDBNQJRDHMPX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|